C29H33N — CID 101028806
(1R,2R,4R)-1,7,7-trimethyl-N-tritylbicyclo[2.2.1]heptan-2-amine (PubChem CID 101028806) has the molecular formula C29H33N and a molecular weight of 395.59 g/mol. Its IUPAC name is (1R,2R,4R)-1,7,7-trimethyl-N-tritylbicyclo[2.2.1]heptan-2-amine.
| Compound Name | (1R,2R,4R)-1,7,7-trimethyl-N-tritylbicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 101028806 |
| Molecular Formula | C29H33N |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | (1R,2R,4R)-1,7,7-trimethyl-N-tritylbicyclo[2.2.1]heptan-2-amine |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H](NC(c1ccccc1)(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C29H33N/c1-27(2)25-19-20-28(27,3)26(21-25)30-29(22-13-7-4-8-14-22,23-15-9-5-10-16-23)24-17-11-6-12-18-24/h4-18,25-26,30H,19-21H2,1-3H3/t25-,26-,28+/m1/s1 |
| InChIKey | BMZCBIUTHDBOCT-GTNKKZTPSA-N |
| XLogP | 6.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|