C14H22N2O3 — CID 101030392
(7R)-7-hydroxy-3-(2-methylpropyl)-8a-prop-2-enyl-3,6,7,8-tetrahydro-2H-pyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 101030392) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is (7R)-7-hydroxy-3-(2-methylpropyl)-8a-prop-2-enyl-3,6,7,8-tetrahydro-2H-pyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (7R)-7-hydroxy-3-(2-methylpropyl)-8a-prop-2-enyl-3,6,7,8-tetrahydro-2H-pyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 101030392 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | (7R)-7-hydroxy-3-(2-methylpropyl)-8a-prop-2-enyl-3,6,7,8-tetrahydro-2H-pyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | C=CCC12C[C@@H](O)CN1C(=O)C(CC(C)C)NC2=O |
| InChI | InChI=1S/C14H22N2O3/c1-4-5-14-7-10(17)8-16(14)12(18)11(6-9(2)3)15-13(14)19/h4,9-11,17H,1,5-8H2,2-3H3,(H,15,19)/t10-,11?,14?/m1/s1 |
| InChIKey | MSVFHRMJZJSZLH-CDWSIMAYSA-N |
| XLogP | 0.44 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|