C18H30N2O3 — CID 101030396
(7R)-8a-(cyclohexylmethyl)-7-hydroxy-3-(2-methylpropyl)-3,6,7,8-tetrahydro-2H-pyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 101030396) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is (7R)-8a-(cyclohexylmethyl)-7-hydroxy-3-(2-methylpropyl)-3,6,7,8-tetrahydro-2H-pyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (7R)-8a-(cyclohexylmethyl)-7-hydroxy-3-(2-methylpropyl)-3,6,7,8-tetrahydro-2H-pyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 101030396 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (7R)-8a-(cyclohexylmethyl)-7-hydroxy-3-(2-methylpropyl)-3,6,7,8-tetrahydro-2H-pyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | CC(C)CC1NC(=O)C2(CC3CCCCC3)C[C@@H](O)CN2C1=O |
| InChI | InChI=1S/C18H30N2O3/c1-12(2)8-15-16(22)20-11-14(21)10-18(20,17(23)19-15)9-13-6-4-3-5-7-13/h12-15,21H,3-11H2,1-2H3,(H,19,23)/t14-,15?,18?/m1/s1 |
| InChIKey | VEAZLAQSWQYECA-KSTDHSDQSA-N |
| XLogP | 1.83 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |