C18H30O11 — CID 101032493
(1R,3R,4R,7R,8R,12R,13S,14S,19R)-4-(hydroxymethyl)-10,10,16,16-tetramethyl-2,5,9,11,15,17,20-heptaoxatetracyclo[10.8.0.03,8.014,19]icosane-6,7,13-triol (PubChem CID 101032493) has the molecular formula C18H30O11 and a molecular weight of 422.43 g/mol. Its IUPAC name is (1R,3R,4R,7R,8R,12R,13S,14S,19R)-4-(hydroxymethyl)-10,10,16,16-tetramethyl-2,5,9,11,15,17,20-heptaoxatetracyclo[10.8.0.03,8.014,19]icosane-6,7,13-triol.
| Compound Name | (1R,3R,4R,7R,8R,12R,13S,14S,19R)-4-(hydroxymethyl)-10,10,16,16-tetramethyl-2,5,9,11,15,17,20-heptaoxatetracyclo[10.8.0.03,8.014,19]icosane-6,7,13-triol |
|---|---|
| PubChem CID | 101032493 |
| Molecular Formula | C18H30O11 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (1R,3R,4R,7R,8R,12R,13S,14S,19R)-4-(hydroxymethyl)-10,10,16,16-tetramethyl-2,5,9,11,15,17,20-heptaoxatetracyclo[10.8.0.03,8.014,19]icosane-6,7,13-triol |
| SMILES | CC1(C)OC[C@H]2O[C@@H]3O[C@H]4[C@H](OC(C)(C)O[C@@H]3[C@@H](O)[C@@H]2O1)[C@@H](O)C(O)O[C@@H]4CO |
| InChI | InChI=1S/C18H30O11/c1-17(2)23-6-8-11(27-17)9(20)14-16(25-8)26-12-7(5-19)24-15(22)10(21)13(12)28-18(3,4)29-14/h7-16,19-22H,5-6H2,1-4H3/t7-,8-,9+,10-,11-,12-,13-,14-,15?,16-/m1/s1 |
| InChIKey | CZKXXKBRGJJDPK-WCWHLQTLSA-N |
| XLogP | -1.80 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |