C36H41NO5 — CID 101032507
[(1R,2R,4S,5R,7R,8R,9R,13R,16S,17R)-7-benzoyloxy-11-ethyl-16-hydroxy-13-methyl-6-methylidene-11-azahexacyclo[7.7.2.15,8.01,10.02,8.013,17]nonadecan-4-yl] benzoate (PubChem CID 101032507) has the molecular formula C36H41NO5 and a molecular weight of 567.73 g/mol. Its IUPAC name is [(1R,2R,4S,5R,7R,8R,9R,13R,16S,17R)-7-benzoyloxy-11-ethyl-16-hydroxy-13-methyl-6-methylidene-11-azahexacyclo[7.7.2.15,8.01,10.02,8.013,17]nonadecan-4-yl] benzoate.
| Compound Name | [(1R,2R,4S,5R,7R,8R,9R,13R,16S,17R)-7-benzoyloxy-11-ethyl-16-hydroxy-13-methyl-6-methylidene-11-azahexacyclo[7.7.2.15,8.01,10.02,8.013,17]nonadecan-4-yl] benzoate |
|---|---|
| PubChem CID | 101032507 |
| Molecular Formula | C36H41NO5 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | [(1R,2R,4S,5R,7R,8R,9R,13R,16S,17R)-7-benzoyloxy-11-ethyl-16-hydroxy-13-methyl-6-methylidene-11-azahexacyclo[7.7.2.15,8.01,10.02,8.013,17]nonadecan-4-yl] benzoate |
| SMILES | C=C1[C@H]2C[C@@]3([C@@H]1OC(=O)c1ccccc1)[C@@H](C[C@@H]2OC(=O)c1ccccc1)[C@@]12C4[C@@H]3C[C@@H]1[C@@](C)(CC[C@@H]2O)CN4CC |
| InChI | InChI=1S/C36H41NO5/c1-4-37-20-34(3)16-15-29(38)36-27(34)17-25(30(36)37)35-19-24(21(2)31(35)42-33(40)23-13-9-6-10-14-23)26(18-28(35)36)41-32(39)22-11-7-5-8-12-22/h5-14,24-31,38H,2,4,15-20H2,1,3H3/t24-,25+,26+,27-,28-,29+,30?,31-,34+,35+,36+/m1/s1 |
| InChIKey | WEPAUOLEZAEPTM-SBMMQWBQSA-N |
| XLogP | 5.52 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|