C29H37NO4 — CID 10504300
[(1R,2R,4S,5S,7R,8R,9S,13R,16S,17R)-11-ethyl-7,16-dihydroxy-13-methyl-6-methylidene-11-azahexacyclo[7.7.2.15,8.01,10.02,8.013,17]nonadecan-4-yl] benzoate (PubChem CID 10504300) has the molecular formula C29H37NO4 and a molecular weight of 463.62 g/mol. Its IUPAC name is [(1R,2R,4S,5S,7R,8R,9S,13R,16S,17R)-11-ethyl-7,16-dihydroxy-13-methyl-6-methylidene-11-azahexacyclo[7.7.2.15,8.01,10.02,8.013,17]nonadecan-4-yl] benzoate.
| Compound Name | [(1R,2R,4S,5S,7R,8R,9S,13R,16S,17R)-11-ethyl-7,16-dihydroxy-13-methyl-6-methylidene-11-azahexacyclo[7.7.2.15,8.01,10.02,8.013,17]nonadecan-4-yl] benzoate |
|---|---|
| PubChem CID | 10504300 |
| Molecular Formula | C29H37NO4 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | [(1R,2R,4S,5S,7R,8R,9S,13R,16S,17R)-11-ethyl-7,16-dihydroxy-13-methyl-6-methylidene-11-azahexacyclo[7.7.2.15,8.01,10.02,8.013,17]nonadecan-4-yl] benzoate |
| SMILES | C=C1[C@@H](O)[C@]23C[C@@H]1[C@@H](OC(=O)c1ccccc1)C[C@H]2[C@@]12C4[C@H]3C[C@@H]1[C@@](C)(CC[C@@H]2O)CN4CC |
| InChI | InChI=1S/C29H37NO4/c1-4-30-15-27(3)11-10-23(31)29-21(27)12-19(24(29)30)28-14-18(16(2)25(28)32)20(13-22(28)29)34-26(33)17-8-6-5-7-9-17/h5-9,18-25,31-32H,2,4,10-15H2,1,3H3/t18-,19+,20-,21+,22+,23-,24?,25+,27-,28-,29-/m0/s1 |
| InChIKey | TVSRLTLFRDEYED-RHHVBBPASA-N |
| XLogP | 3.66 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|