C29H50O4 — CID 101032514
(3S,5R,6R,8S,9S,10R,13S,14S)-17-[(2S)-6-hydroxy-4,5,6-trimethylheptan-2-yl]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthrene-3,5,6-triol (PubChem CID 101032514) has the molecular formula C29H50O4 and a molecular weight of 462.72 g/mol. Its IUPAC name is (3S,5R,6R,8S,9S,10R,13S,14S)-17-[(2S)-6-hydroxy-4,5,6-trimethylheptan-2-yl]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthrene-3,5,6-triol.
| Compound Name | (3S,5R,6R,8S,9S,10R,13S,14S)-17-[(2S)-6-hydroxy-4,5,6-trimethylheptan-2-yl]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthrene-3,5,6-triol |
|---|---|
| PubChem CID | 101032514 |
| Molecular Formula | C29H50O4 |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.37 |
| IUPAC Name | (3S,5R,6R,8S,9S,10R,13S,14S)-17-[(2S)-6-hydroxy-4,5,6-trimethylheptan-2-yl]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthrene-3,5,6-triol |
| SMILES | CC(C[C@H](C)C1=CC[C@H]2[C@@H]3C[C@@H](O)[C@@]4(O)C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C(C)(C)O |
| InChI | InChI=1S/C29H50O4/c1-17(19(3)26(4,5)32)14-18(2)22-8-9-23-21-15-25(31)29(33)16-20(30)10-13-28(29,7)24(21)11-12-27(22,23)6/h8,17-21,23-25,30-33H,9-16H2,1-7H3/t17?,18-,19?,20-,21-,23-,24-,25+,27+,28+,29-/m0/s1 |
| InChIKey | JUCPPQHRQNUYEK-SIUZBHLUSA-N |
| XLogP | 5.08 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|