C31H52O7 — CID 163114061
[6-(16-hydroperoxy-3,5,6-trihydroxy-10,13-dimethyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene)-2,3,4-trimethylheptan-2-yl] acetate (PubChem CID 163114061) has the molecular formula C31H52O7 and a molecular weight of 536.75 g/mol. Its IUPAC name is [6-(16-hydroperoxy-3,5,6-trihydroxy-10,13-dimethyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene)-2,3,4-trimethylheptan-2-yl] acetate.
| Compound Name | [6-(16-hydroperoxy-3,5,6-trihydroxy-10,13-dimethyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene)-2,3,4-trimethylheptan-2-yl] acetate |
|---|---|
| PubChem CID | 163114061 |
| Molecular Formula | C31H52O7 |
| Molecular Weight | 536.75 g/mol |
| Exact Mass | 536.37 |
| IUPAC Name | [6-(16-hydroperoxy-3,5,6-trihydroxy-10,13-dimethyl-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene)-2,3,4-trimethylheptan-2-yl] acetate |
| SMILES | CC(=O)OC(C)(C)C(C)C(C)CC(C)=C1C(OO)CC2C3CC(O)C4(O)CC(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C31H52O7/c1-17(19(3)28(5,6)37-20(4)32)13-18(2)27-25(38-36)15-24-22-14-26(34)31(35)16-21(33)9-12-30(31,8)23(22)10-11-29(24,27)7/h17,19,21-26,33-36H,9-16H2,1-8H3 |
| InChIKey | UOFXQDRLLWOZKL-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.75 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|