C31H52O6 — CID 162870950
[3,5,6,16-tetrahydroxy-10,13-dimethyl-17-(4,5,6-trimethylheptan-2-ylidene)-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-yl] acetate (PubChem CID 162870950) has the molecular formula C31H52O6 and a molecular weight of 520.75 g/mol. Its IUPAC name is [3,5,6,16-tetrahydroxy-10,13-dimethyl-17-(4,5,6-trimethylheptan-2-ylidene)-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-yl] acetate.
| Compound Name | [3,5,6,16-tetrahydroxy-10,13-dimethyl-17-(4,5,6-trimethylheptan-2-ylidene)-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-yl] acetate |
|---|---|
| PubChem CID | 162870950 |
| Molecular Formula | C31H52O6 |
| Molecular Weight | 520.75 g/mol |
| Exact Mass | 520.38 |
| IUPAC Name | [3,5,6,16-tetrahydroxy-10,13-dimethyl-17-(4,5,6-trimethylheptan-2-ylidene)-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-yl] acetate |
| SMILES | CC(=O)OC1CC2(C)C(=C(C)CC(C)C(C)C(C)C)C(O)CC2C2CC(O)C3(O)CC(O)CCC3(C)C12 |
| InChI | InChI=1S/C31H52O6/c1-16(2)19(5)17(3)11-18(4)27-24(34)13-23-22-12-26(35)31(36)14-21(33)9-10-30(31,8)28(22)25(37-20(6)32)15-29(23,27)7/h16-17,19,21-26,28,33-36H,9-15H2,1-8H3 |
| InChIKey | DUEKIALBULZRSH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.75 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|