C29H48O5 — CID 163136556
[(3S,5R,6R,8S,9S,10R,11S,13R,14S,17R)-3,5,11-trihydroxy-10,13-dimethyl-17-[(E,2R)-6-methylhept-3-en-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-yl] acetate (PubChem CID 163136556) has the molecular formula C29H48O5 and a molecular weight of 476.70 g/mol. Its IUPAC name is [(3S,5R,6R,8S,9S,10R,11S,13R,14S,17R)-3,5,11-trihydroxy-10,13-dimethyl-17-[(E,2R)-6-methylhept-3-en-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-yl] acetate.
| Compound Name | [(3S,5R,6R,8S,9S,10R,11S,13R,14S,17R)-3,5,11-trihydroxy-10,13-dimethyl-17-[(E,2R)-6-methylhept-3-en-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-yl] acetate |
|---|---|
| PubChem CID | 163136556 |
| Molecular Formula | C29H48O5 |
| Molecular Weight | 476.70 g/mol |
| Exact Mass | 476.35 |
| IUPAC Name | [(3S,5R,6R,8S,9S,10R,11S,13R,14S,17R)-3,5,11-trihydroxy-10,13-dimethyl-17-[(E,2R)-6-methylhept-3-en-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H]2[C@H]([C@@H](O)C[C@]3(C)[C@@H]([C@H](C)/C=C/CC(C)C)CC[C@@H]23)[C@@]2(C)CC[C@H](O)C[C@]12O |
| InChI | InChI=1S/C29H48O5/c1-17(2)8-7-9-18(3)22-10-11-23-21-14-25(34-19(4)30)29(33)15-20(31)12-13-28(29,6)26(21)24(32)16-27(22,23)5/h7,9,17-18,20-26,31-33H,8,10-16H2,1-6H3/b9-7+/t18-,20+,21+,22-,23+,24+,25-,26-,27-,28-,29+/m1/s1 |
| InChIKey | IDYWJEBGZUJSDJ-MNTDZUDWSA-N |
| XLogP | 4.87 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.70 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|