C28H46O2 — CID 163057479
[(3S,5S,8R,9R,10S,13R,14R,17S)-13-methyl-17-[(Z,2S)-6-methylhept-3-en-2-yl]-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 163057479) has the molecular formula C28H46O2 and a molecular weight of 414.67 g/mol. Its IUPAC name is [(3S,5S,8R,9R,10S,13R,14R,17S)-13-methyl-17-[(Z,2S)-6-methylhept-3-en-2-yl]-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5S,8R,9R,10S,13R,14R,17S)-13-methyl-17-[(Z,2S)-6-methylhept-3-en-2-yl]-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 163057479 |
| Molecular Formula | C28H46O2 |
| Molecular Weight | 414.67 g/mol |
| Exact Mass | 414.35 |
| IUPAC Name | [(3S,5S,8R,9R,10S,13R,14R,17S)-13-methyl-17-[(Z,2S)-6-methylhept-3-en-2-yl]-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@H]2[C@@H](CC[C@@H]3[C@@H]2CC[C@@]2(C)[C@@H]3CC[C@H]2[C@@H](C)/C=C\CC(C)C)C1 |
| InChI | InChI=1S/C28H46O2/c1-18(2)7-6-8-19(3)26-13-14-27-25-11-9-21-17-22(30-20(4)29)10-12-23(21)24(25)15-16-28(26,27)5/h6,8,18-19,21-27H,7,9-17H2,1-5H3/b8-6-/t19-,21-,22-,23-,24+,25+,26-,27+,28+/m0/s1 |
| InChIKey | UCACJVAPKGZMLE-NEXQQKDZSA-N |
| XLogP | 7.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.67 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|