C24H42O6 — CID 123985163
17-(1,1-dimethoxyethyl)-6-methoxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,5,11-triol (PubChem CID 123985163) has the molecular formula C24H42O6 and a molecular weight of 426.59 g/mol. Its IUPAC name is 17-(1,1-dimethoxyethyl)-6-methoxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,5,11-triol.
| Compound Name | 17-(1,1-dimethoxyethyl)-6-methoxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,5,11-triol |
|---|---|
| PubChem CID | 123985163 |
| Molecular Formula | C24H42O6 |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | 17-(1,1-dimethoxyethyl)-6-methoxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,5,11-triol |
| SMILES | COC1CC2C3CCC(C(C)(OC)OC)C3(C)CC(O)C2C2(C)CCC(O)CC12O |
| InChI | InChI=1S/C24H42O6/c1-21-13-17(26)20-15(16(21)7-8-18(21)23(3,29-5)30-6)11-19(28-4)24(27)12-14(25)9-10-22(20,24)2/h14-20,25-27H,7-13H2,1-6H3 |
| InChIKey | BQYHAYXBEFYIFI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|