C28H50O5 — CID 162946705
17-(5,6-dimethylheptan-2-yl)-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,5,6,11,15-pentol (PubChem CID 162946705) has the molecular formula C28H50O5 and a molecular weight of 466.70 g/mol. Its IUPAC name is 17-(5,6-dimethylheptan-2-yl)-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,5,6,11,15-pentol.
| Compound Name | 17-(5,6-dimethylheptan-2-yl)-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,5,6,11,15-pentol |
|---|---|
| PubChem CID | 162946705 |
| Molecular Formula | C28H50O5 |
| Molecular Weight | 466.70 g/mol |
| Exact Mass | 466.37 |
| IUPAC Name | 17-(5,6-dimethylheptan-2-yl)-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,5,6,11,15-pentol |
| SMILES | CC(C)C(C)CCC(C)C1CC(O)C2C3CC(O)C4(O)CC(O)CCC4(C)C3C(O)CC12C |
| InChI | InChI=1S/C28H50O5/c1-15(2)16(3)7-8-17(4)20-12-21(30)24-19-11-23(32)28(33)13-18(29)9-10-27(28,6)25(19)22(31)14-26(20,24)5/h15-25,29-33H,7-14H2,1-6H3 |
| InChIKey | HSLMICUZTNTHMQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.70 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |