C32H56O12S — CID 163181619
[4,5-dihydroxy-6-[2-methyl-6-(3,5,6,15-tetrahydroxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)heptan-3-yl]oxyoxan-3-yl] hydrogen sulfate (PubChem CID 163181619) has the molecular formula C32H56O12S and a molecular weight of 664.86 g/mol. Its IUPAC name is [4,5-dihydroxy-6-[2-methyl-6-(3,5,6,15-tetrahydroxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)heptan-3-yl]oxyoxan-3-yl] hydrogen sulfate.
| Compound Name | [4,5-dihydroxy-6-[2-methyl-6-(3,5,6,15-tetrahydroxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)heptan-3-yl]oxyoxan-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 163181619 |
| Molecular Formula | C32H56O12S |
| Molecular Weight | 664.86 g/mol |
| Exact Mass | 664.35 |
| IUPAC Name | [4,5-dihydroxy-6-[2-methyl-6-(3,5,6,15-tetrahydroxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)heptan-3-yl]oxyoxan-3-yl] hydrogen sulfate |
| SMILES | CC(C)C(CCC(C)C1CC(O)C2C3CC(O)C4(O)CC(O)CCC4(C)C3CCC12C)OC1OCC(OS(=O)(=O)O)C(O)C1O |
| InChI | InChI=1S/C32H56O12S/c1-16(2)23(43-29-28(37)27(36)24(15-42-29)44-45(39,40)41)7-6-17(3)21-13-22(34)26-19-12-25(35)32(38)14-18(33)8-11-31(32,5)20(19)9-10-30(21,26)4/h16-29,33-38H,6-15H2,1-5H3,(H,39,40,41) |
| InChIKey | ZIHCPNHLEKVOGL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 203.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.86 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|