C27H48O8S — CID 10459700
[(3S,5R,6R,10R,13R,15S,17R)-3,5,6-trihydroxy-17-[(2R,5S)-5-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-15-yl] hydrogen sulfate (PubChem CID 10459700) has the molecular formula C27H48O8S and a molecular weight of 532.74 g/mol. Its IUPAC name is [(3S,5R,6R,10R,13R,15S,17R)-3,5,6-trihydroxy-17-[(2R,5S)-5-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-15-yl] hydrogen sulfate.
| Compound Name | [(3S,5R,6R,10R,13R,15S,17R)-3,5,6-trihydroxy-17-[(2R,5S)-5-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-15-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 10459700 |
| Molecular Formula | C27H48O8S |
| Molecular Weight | 532.74 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | [(3S,5R,6R,10R,13R,15S,17R)-3,5,6-trihydroxy-17-[(2R,5S)-5-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-15-yl] hydrogen sulfate |
| SMILES | CC(C)[C@@H](O)CC[C@@H](C)[C@H]1CC(OS(=O)(=O)O)C2C3C[C@@H](O)[C@@]4(O)C[C@@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C27H48O8S/c1-15(2)21(29)7-6-16(3)20-13-22(35-36(32,33)34)24-18-12-23(30)27(31)14-17(28)8-11-26(27,5)19(18)9-10-25(20,24)4/h15-24,28-31H,6-14H2,1-5H3,(H,32,33,34)/t16-,17+,18?,19?,20-,21+,22?,23-,24?,25-,26-,27+/m1/s1 |
| InChIKey | HYOCMBNXSGMCAY-YDFMQBECSA-N |
| XLogP | 3.32 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.74 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|