C28H50O4 — CID 23427574
(5R)-17-[(2R)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-1,3,5,6-tetrol (PubChem CID 23427574) has the molecular formula C28H50O4 and a molecular weight of 450.70 g/mol. Its IUPAC name is (5R)-17-[(2R)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-1,3,5,6-tetrol.
| Compound Name | (5R)-17-[(2R)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-1,3,5,6-tetrol |
|---|---|
| PubChem CID | 23427574 |
| Molecular Formula | C28H50O4 |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 450.37 |
| IUPAC Name | (5R)-17-[(2R)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-1,3,5,6-tetrol |
| SMILES | CC(C)C(C)CC[C@@H](C)C1CCC2C3CC(O)[C@@]4(O)CC(O)CC(O)C4(C)C3CCC21C |
| InChI | InChI=1S/C28H50O4/c1-16(2)17(3)7-8-18(4)21-9-10-22-20-14-25(31)28(32)15-19(29)13-24(30)27(28,6)23(20)11-12-26(21,22)5/h16-25,29-32H,7-15H2,1-6H3/t17?,18-,19?,20?,21?,22?,23?,24?,25?,26?,27?,28+/m1/s1 |
| InChIKey | RGALWYBFQVYHJV-VACPBSEGSA-N |
| XLogP | 4.77 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |