C28H48O5 — CID 20847623
(8S,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-1,3,5,6,11-pentol (PubChem CID 20847623) has the molecular formula C28H48O5 and a molecular weight of 464.69 g/mol. Its IUPAC name is (8S,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-1,3,5,6,11-pentol.
| Compound Name | (8S,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-1,3,5,6,11-pentol |
|---|---|
| PubChem CID | 20847623 |
| Molecular Formula | C28H48O5 |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 464.35 |
| IUPAC Name | (8S,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-1,3,5,6,11-pentol |
| SMILES | C=C(CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC(O)C4(O)CC(O)CC(O)[C@]4(C)[C@H]3C(O)C[C@]12C)C(C)C |
| InChI | InChI=1S/C28H48O5/c1-15(2)16(3)7-8-17(4)20-9-10-21-19-12-24(32)28(33)13-18(29)11-23(31)27(28,6)25(19)22(30)14-26(20,21)5/h15,17-25,29-33H,3,7-14H2,1-2,4-6H3/t17-,18?,19+,20-,21+,22?,23?,24?,25-,26-,27-,28?/m1/s1 |
| InChIKey | JYCGOEKALXJDNM-UWXWUTEUSA-N |
| XLogP | 3.66 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|