C27H35NO7 — CID 101033497
tert-butyl 2-[(5R)-3-benzyl-5-[(4-methoxyphenyl)methoxymethoxymethyl]-2-oxo-1,3-oxazinan-4-yl]acetate (PubChem CID 101033497) has the molecular formula C27H35NO7 and a molecular weight of 485.58 g/mol. Its IUPAC name is tert-butyl 2-[(5R)-3-benzyl-5-[(4-methoxyphenyl)methoxymethoxymethyl]-2-oxo-1,3-oxazinan-4-yl]acetate.
| Compound Name | tert-butyl 2-[(5R)-3-benzyl-5-[(4-methoxyphenyl)methoxymethoxymethyl]-2-oxo-1,3-oxazinan-4-yl]acetate |
|---|---|
| PubChem CID | 101033497 |
| Molecular Formula | C27H35NO7 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | tert-butyl 2-[(5R)-3-benzyl-5-[(4-methoxyphenyl)methoxymethoxymethyl]-2-oxo-1,3-oxazinan-4-yl]acetate |
| SMILES | COc1ccc(COCOC[C@@H]2COC(=O)N(Cc3ccccc3)C2CC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H35NO7/c1-27(2,3)35-25(29)14-24-22(17-33-19-32-16-21-10-12-23(31-4)13-11-21)18-34-26(30)28(24)15-20-8-6-5-7-9-20/h5-13,22,24H,14-19H2,1-4H3/t22-,24?/m1/s1 |
| InChIKey | QZVKHRXWFVDUKQ-LETIRJCYSA-N |
| XLogP | 4.55 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|