C14H17F3O2 — CID 101034644
6,6,6-trifluoro-5-(2-methoxyphenyl)-3-methylhex-1-en-3-ol (PubChem CID 101034644) has the molecular formula C14H17F3O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 6,6,6-trifluoro-5-(2-methoxyphenyl)-3-methylhex-1-en-3-ol.
| Compound Name | 6,6,6-trifluoro-5-(2-methoxyphenyl)-3-methylhex-1-en-3-ol |
|---|---|
| PubChem CID | 101034644 |
| Molecular Formula | C14H17F3O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 6,6,6-trifluoro-5-(2-methoxyphenyl)-3-methylhex-1-en-3-ol |
| SMILES | C=CC(C)(O)CC(c1ccccc1OC)C(F)(F)F |
| InChI | InChI=1S/C14H17F3O2/c1-4-13(2,18)9-11(14(15,16)17)10-7-5-6-8-12(10)19-3/h4-8,11,18H,1,9H2,2-3H3 |
| InChIKey | QRYPSWMKILDZIF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|