C12H17F3O8 — CID 101034850
(4-hydroxy-3-methyl-5-oxooxolan-3-yl) (2S)-3,3,3-trifluoro-2-(2-methoxyethoxymethoxy)propanoate (PubChem CID 101034850) has the molecular formula C12H17F3O8 and a molecular weight of 346.25 g/mol. Its IUPAC name is (4-hydroxy-3-methyl-5-oxooxolan-3-yl) (2S)-3,3,3-trifluoro-2-(2-methoxyethoxymethoxy)propanoate.
| Compound Name | (4-hydroxy-3-methyl-5-oxooxolan-3-yl) (2S)-3,3,3-trifluoro-2-(2-methoxyethoxymethoxy)propanoate |
|---|---|
| PubChem CID | 101034850 |
| Molecular Formula | C12H17F3O8 |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | (4-hydroxy-3-methyl-5-oxooxolan-3-yl) (2S)-3,3,3-trifluoro-2-(2-methoxyethoxymethoxy)propanoate |
| SMILES | COCCOCO[C@@H](C(=O)OC1(C)COC(=O)C1O)C(F)(F)F |
| InChI | InChI=1S/C12H17F3O8/c1-11(5-21-9(17)7(11)16)23-10(18)8(12(13,14)15)22-6-20-4-3-19-2/h7-8,16H,3-6H2,1-2H3/t7?,8-,11?/m0/s1 |
| InChIKey | VZEBHCYRLDHPEJ-KAIZJQOQSA-N |
| XLogP | -0.23 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|