C10H13F3O7 — CID 101034861
(4-hydroxy-3-methyl-5-oxooxolan-3-yl) (2S)-3,3,3-trifluoro-2-(methoxymethoxy)propanoate (PubChem CID 101034861) has the molecular formula C10H13F3O7 and a molecular weight of 302.20 g/mol. Its IUPAC name is (4-hydroxy-3-methyl-5-oxooxolan-3-yl) (2S)-3,3,3-trifluoro-2-(methoxymethoxy)propanoate.
| Compound Name | (4-hydroxy-3-methyl-5-oxooxolan-3-yl) (2S)-3,3,3-trifluoro-2-(methoxymethoxy)propanoate |
|---|---|
| PubChem CID | 101034861 |
| Molecular Formula | C10H13F3O7 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | (4-hydroxy-3-methyl-5-oxooxolan-3-yl) (2S)-3,3,3-trifluoro-2-(methoxymethoxy)propanoate |
| SMILES | COCO[C@@H](C(=O)OC1(C)COC(=O)C1O)C(F)(F)F |
| InChI | InChI=1S/C10H13F3O7/c1-9(3-18-7(15)5(9)14)20-8(16)6(10(11,12)13)19-4-17-2/h5-6,14H,3-4H2,1-2H3/t5?,6-,9?/m0/s1 |
| InChIKey | ZELPCOXNHHEBFG-KJXBMWQCSA-N |
| XLogP | -0.24 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|