C16H18O3 — CID 101035013
(1R,5S)-1-butyl-5-phenyl-6-oxabicyclo[3.2.0]heptane-2,7-dione (PubChem CID 101035013) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is (1R,5S)-1-butyl-5-phenyl-6-oxabicyclo[3.2.0]heptane-2,7-dione.
| Compound Name | (1R,5S)-1-butyl-5-phenyl-6-oxabicyclo[3.2.0]heptane-2,7-dione |
|---|---|
| PubChem CID | 101035013 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (1R,5S)-1-butyl-5-phenyl-6-oxabicyclo[3.2.0]heptane-2,7-dione |
| SMILES | CCCC[C@]12C(=O)CC[C@@]1(c1ccccc1)OC2=O |
| InChI | InChI=1S/C16H18O3/c1-2-3-10-15-13(17)9-11-16(15,19-14(15)18)12-7-5-4-6-8-12/h4-8H,2-3,9-11H2,1H3/t15-,16+/m1/s1 |
| InChIKey | YBIROPSXGJWWTP-CVEARBPZSA-N |
| XLogP | 2.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|