C18H26N4O4 — CID 101037519
1-N,3-N-bis(diethylcarbamoyl)benzene-1,3-dicarboxamide (PubChem CID 101037519) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 1-N,3-N-bis(diethylcarbamoyl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(diethylcarbamoyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 101037519 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1-N,3-N-bis(diethylcarbamoyl)benzene-1,3-dicarboxamide |
| SMILES | CCN(CC)C(=O)NC(=O)c1cccc(C(=O)NC(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C18H26N4O4/c1-5-21(6-2)17(25)19-15(23)13-10-9-11-14(12-13)16(24)20-18(26)22(7-3)8-4/h9-12H,5-8H2,1-4H3,(H,19,23,25)(H,20,24,26) |
| InChIKey | FIKMQKMRLYCVEE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |