C15H30O6Si — CID 101038266
(2S,3S,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carbaldehyde (PubChem CID 101038266) has the molecular formula C15H30O6Si and a molecular weight of 334.49 g/mol. Its IUPAC name is (2S,3S,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carbaldehyde.
| Compound Name | (2S,3S,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carbaldehyde |
|---|---|
| PubChem CID | 101038266 |
| Molecular Formula | C15H30O6Si |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (2S,3S,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carbaldehyde |
| SMILES | CO[C@]1(C)O[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C=O)O[C@@]1(C)OC |
| InChI | InChI=1S/C15H30O6Si/c1-13(2,3)22(8,9)21-12-11(10-16)19-14(4,17-6)15(5,18-7)20-12/h10-12H,1-9H3/t11-,12-,14+,15+/m0/s1 |
| InChIKey | YRGAGNZHBRHMTM-DDHJSBNISA-N |
| XLogP | 2.67 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|