C16H26O2 — CID 101038826
(1E)-1-(5-tert-butyl-2,2-dimethylfuran-3-ylidene)-3,3-dimethylbutan-2-one (PubChem CID 101038826) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (1E)-1-(5-tert-butyl-2,2-dimethylfuran-3-ylidene)-3,3-dimethylbutan-2-one.
| Compound Name | (1E)-1-(5-tert-butyl-2,2-dimethylfuran-3-ylidene)-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 101038826 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (1E)-1-(5-tert-butyl-2,2-dimethylfuran-3-ylidene)-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)/C=C1\C=C(C(C)(C)C)OC1(C)C |
| InChI | InChI=1S/C16H26O2/c1-14(2,3)12(17)9-11-10-13(15(4,5)6)18-16(11,7)8/h9-10H,1-8H3/b11-9+ |
| InChIKey | NXEQYXJAQYYTIY-PKNBQFBNSA-N |
| XLogP | 4.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|