C45H49N5O — CID 101040103
N-(anthracen-9-ylmethyl)-2-(5,5,10,10,15,15,20,20-octamethyl-21,22,23,24-tetrahydroporphyrin-2-yl)acetamide (PubChem CID 101040103) has the molecular formula C45H49N5O and a molecular weight of 675.92 g/mol. Its IUPAC name is N-(anthracen-9-ylmethyl)-2-(5,5,10,10,15,15,20,20-octamethyl-21,22,23,24-tetrahydroporphyrin-2-yl)acetamide.
| Compound Name | N-(anthracen-9-ylmethyl)-2-(5,5,10,10,15,15,20,20-octamethyl-21,22,23,24-tetrahydroporphyrin-2-yl)acetamide |
|---|---|
| PubChem CID | 101040103 |
| Molecular Formula | C45H49N5O |
| Molecular Weight | 675.92 g/mol |
| Exact Mass | 675.39 |
| IUPAC Name | N-(anthracen-9-ylmethyl)-2-(5,5,10,10,15,15,20,20-octamethyl-21,22,23,24-tetrahydroporphyrin-2-yl)acetamide |
| SMILES | CC1(C)c2ccc([nH]2)C(C)(C)c2ccc([nH]2)C(C)(C)c2[nH]c(cc2CC(=O)NCc2c3ccccc3cc3ccccc23)C(C)(C)c2ccc1[nH]2 |
| InChI | InChI=1S/C45H49N5O/c1-42(2)33-17-18-34(47-33)43(3,4)36-21-22-38(49-36)45(7,8)41-29(24-39(50-41)44(5,6)37-20-19-35(42)48-37)25-40(51)46-26-32-30-15-11-9-13-27(30)23-28-14-10-12-16-31(28)32/h9-24,47-50H,25-26H2,1-8H3,(H,46,51) |
| InChIKey | IXIFHNNLLYLURK-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.92 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|