C17H28N2O5 — CID 101040687
tert-butyl (5S)-5-[(2S)-2-(methoxymethoxy)pyrrolidine-1-carbonyl]-5-methyl-2H-pyrrole-1-carboxylate (PubChem CID 101040687) has the molecular formula C17H28N2O5 and a molecular weight of 340.42 g/mol. Its IUPAC name is tert-butyl (5S)-5-[(2S)-2-(methoxymethoxy)pyrrolidine-1-carbonyl]-5-methyl-2H-pyrrole-1-carboxylate.
| Compound Name | tert-butyl (5S)-5-[(2S)-2-(methoxymethoxy)pyrrolidine-1-carbonyl]-5-methyl-2H-pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 101040687 |
| Molecular Formula | C17H28N2O5 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | tert-butyl (5S)-5-[(2S)-2-(methoxymethoxy)pyrrolidine-1-carbonyl]-5-methyl-2H-pyrrole-1-carboxylate |
| SMILES | COCO[C@H]1CCCN1C(=O)[C@]1(C)C=CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H28N2O5/c1-16(2,3)24-15(21)19-11-7-9-17(19,4)14(20)18-10-6-8-13(18)23-12-22-5/h7,9,13H,6,8,10-12H2,1-5H3/t13-,17-/m0/s1 |
| InChIKey | VJTPWUNARKDNNH-GUYCJALGSA-N |
| XLogP | 2.12 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|