C36H38N2O8Si — CID 101041261
(4-nitrophenyl)methyl (5R,6S)-3-[6-(hydroxymethyl)-9-oxofluoren-2-yl]-7-oxo-6-[(1R)-1-triethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 101041261) has the molecular formula C36H38N2O8Si and a molecular weight of 654.79 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R,6S)-3-[6-(hydroxymethyl)-9-oxofluoren-2-yl]-7-oxo-6-[(1R)-1-triethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R,6S)-3-[6-(hydroxymethyl)-9-oxofluoren-2-yl]-7-oxo-6-[(1R)-1-triethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 101041261 |
| Molecular Formula | C36H38N2O8Si |
| Molecular Weight | 654.79 g/mol |
| Exact Mass | 654.24 |
| IUPAC Name | (4-nitrophenyl)methyl (5R,6S)-3-[6-(hydroxymethyl)-9-oxofluoren-2-yl]-7-oxo-6-[(1R)-1-triethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC[Si](CC)(CC)O[C@H](C)[C@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(c3ccc4c(c3)C(=O)c3ccc(CO)cc3-4)C[C@H]12 |
| InChI | InChI=1S/C36H38N2O8Si/c1-5-47(6-2,7-3)46-21(4)32-31-18-28(24-11-15-26-29-16-23(19-39)10-14-27(29)34(40)30(26)17-24)33(37(31)35(32)41)36(42)45-20-22-8-12-25(13-9-22)38(43)44/h8-17,21,31-32,39H,5-7,18-20H2,1-4H3/t21-,31-,32-/m1/s1 |
| InChIKey | DVUKMJMNPWMDJZ-JJDYZBRISA-N |
| XLogP | 6.39 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.79 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|