C25H27N5O5 — CID 101041602
benzyl (2S)-2-[(1S)-1-azido-2-[(4S,5R)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]-2-oxoethyl]piperidine-1-carboxylate (PubChem CID 101041602) has the molecular formula C25H27N5O5 and a molecular weight of 477.52 g/mol. Its IUPAC name is benzyl (2S)-2-[(1S)-1-azido-2-[(4S,5R)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]-2-oxoethyl]piperidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-[(1S)-1-azido-2-[(4S,5R)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]-2-oxoethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 101041602 |
| Molecular Formula | C25H27N5O5 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | benzyl (2S)-2-[(1S)-1-azido-2-[(4S,5R)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]-2-oxoethyl]piperidine-1-carboxylate |
| SMILES | C[C@H]1[C@@H](c2ccccc2)OC(=O)N1C(=O)[C@@H](N=[N+]=[N-])[C@@H]1CCCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H27N5O5/c1-17-22(19-12-6-3-7-13-19)35-25(33)30(17)23(31)21(27-28-26)20-14-8-9-15-29(20)24(32)34-16-18-10-4-2-5-11-18/h2-7,10-13,17,20-22H,8-9,14-16H2,1H3/t17-,20-,21-,22-/m0/s1 |
| InChIKey | BDOCRESCPPHDLG-MQGJPIDWSA-N |
| XLogP | 4.97 |
| TPSA | 124.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|