C19H35BO2 — CID 101043870
4,4,5,5-tetramethyl-2-[(4E)-2,5,9-trimethyldeca-4,8-dien-3-yl]-1,3,2-dioxaborolane (PubChem CID 101043870) has the molecular formula C19H35BO2 and a molecular weight of 306.30 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(4E)-2,5,9-trimethyldeca-4,8-dien-3-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(4E)-2,5,9-trimethyldeca-4,8-dien-3-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 101043870 |
| Molecular Formula | C19H35BO2 |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(4E)-2,5,9-trimethyldeca-4,8-dien-3-yl]-1,3,2-dioxaborolane |
| SMILES | CC(C)=CCC/C(C)=C/C(B1OC(C)(C)C(C)(C)O1)C(C)C |
| InChI | InChI=1S/C19H35BO2/c1-14(2)11-10-12-16(5)13-17(15(3)4)20-21-18(6,7)19(8,9)22-20/h11,13,15,17H,10,12H2,1-9H3/b16-13+ |
| InChIKey | UIVMQSJWTJZENT-DTQAZKPQSA-N |
| XLogP | 5.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|