C29H49BO2 — CID 101043901
2-[(6E,10E)-9-cyclopropyl-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 101043901) has the molecular formula C29H49BO2 and a molecular weight of 440.52 g/mol. Its IUPAC name is 2-[(6E,10E)-9-cyclopropyl-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(6E,10E)-9-cyclopropyl-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 101043901 |
| Molecular Formula | C29H49BO2 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.38 |
| IUPAC Name | 2-[(6E,10E)-9-cyclopropyl-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)=CCC/C(C)=C/C(B1OC(C)(C)C(C)(C)O1)C(/C=C(\C)CCC=C(C)C)C1CC1 |
| InChI | InChI=1S/C29H49BO2/c1-21(2)13-11-15-23(5)19-26(25-17-18-25)27(20-24(6)16-12-14-22(3)4)30-31-28(7,8)29(9,10)32-30/h13-14,19-20,25-27H,11-12,15-18H2,1-10H3/b23-19+,24-20+ |
| InChIKey | BZPWNTKZVYFEQI-BLVCXSLXSA-N |
| XLogP | 8.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|