C17H31BO2 — CID 11208192
4,4,5,5-tetramethyl-2-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopropyl]-1,3,2-dioxaborolane (PubChem CID 11208192) has the molecular formula C17H31BO2 and a molecular weight of 278.24 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopropyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopropyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 11208192 |
| Molecular Formula | C17H31BO2 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopropyl]-1,3,2-dioxaborolane |
| SMILES | CCCCCC/C=C/[C@H]1C[C@@H]1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H31BO2/c1-6-7-8-9-10-11-12-14-13-15(14)18-19-16(2,3)17(4,5)20-18/h11-12,14-15H,6-10,13H2,1-5H3/b12-11+/t14-,15-/m0/s1 |
| InChIKey | XGSPRQSQJNBNDB-NOQIOLJMSA-N |
| XLogP | 5.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|