C12H22O3 — CID 10104691
ethyl (2R)-2-[(1R)-1-hydroxy-2,2-dimethylpropyl]pent-4-enoate (PubChem CID 10104691) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is ethyl (2R)-2-[(1R)-1-hydroxy-2,2-dimethylpropyl]pent-4-enoate.
| Compound Name | ethyl (2R)-2-[(1R)-1-hydroxy-2,2-dimethylpropyl]pent-4-enoate |
|---|---|
| PubChem CID | 10104691 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | ethyl (2R)-2-[(1R)-1-hydroxy-2,2-dimethylpropyl]pent-4-enoate |
| SMILES | C=CC[C@@H](C(=O)OCC)[C@@H](O)C(C)(C)C |
| InChI | InChI=1S/C12H22O3/c1-6-8-9(11(14)15-7-2)10(13)12(3,4)5/h6,9-10,13H,1,7-8H2,2-5H3/t9-,10-/m1/s1 |
| InChIKey | VRXAYMLXMUDKNE-NXEZZACHSA-N |
| XLogP | 2.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|