C17H16N4O — CID 101048802
3,5-bis(5-methyl-2-pyridinyl)-1,6-dihydro-1,4-diazepin-7-one (PubChem CID 101048802) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 3,5-bis(5-methyl-2-pyridinyl)-1,6-dihydro-1,4-diazepin-7-one.
| Compound Name | 3,5-bis(5-methyl-2-pyridinyl)-1,6-dihydro-1,4-diazepin-7-one |
|---|---|
| PubChem CID | 101048802 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3,5-bis(5-methyl-2-pyridinyl)-1,6-dihydro-1,4-diazepin-7-one |
| SMILES | Cc1ccc(C2=CNC(=O)CC(c3ccc(C)cn3)=N2)nc1 |
| InChI | InChI=1S/C17H16N4O/c1-11-3-5-13(18-8-11)15-7-17(22)20-10-16(21-15)14-6-4-12(2)9-19-14/h3-6,8-10H,7H2,1-2H3,(H,20,22) |
| InChIKey | HKUDVXJZZXOASD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |