C11H13N — CID 57273992
2-(cyclopenten-1-yl)-5-methylpyridine (PubChem CID 57273992) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-(cyclopenten-1-yl)-5-methylpyridine.
| Compound Name | 2-(cyclopenten-1-yl)-5-methylpyridine |
|---|---|
| PubChem CID | 57273992 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 2-(cyclopenten-1-yl)-5-methylpyridine |
| SMILES | Cc1ccc(C2=CCCC2)nc1 |
| InChI | InChI=1S/C11H13N/c1-9-6-7-11(12-8-9)10-4-2-3-5-10/h4,6-8H,2-3,5H2,1H3 |
| InChIKey | SZQYSXOBLGJGFB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |