C10H15NO5 — CID 101049290
diethyl (2S,3R)-2-cyano-3-hydroxy-2-methylbutanedioate (PubChem CID 101049290) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is diethyl (2S,3R)-2-cyano-3-hydroxy-2-methylbutanedioate.
| Compound Name | diethyl (2S,3R)-2-cyano-3-hydroxy-2-methylbutanedioate |
|---|---|
| PubChem CID | 101049290 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | diethyl (2S,3R)-2-cyano-3-hydroxy-2-methylbutanedioate |
| SMILES | CCOC(=O)[C@H](O)[C@](C)(C#N)C(=O)OCC |
| InChI | InChI=1S/C10H15NO5/c1-4-15-8(13)7(12)10(3,6-11)9(14)16-5-2/h7,12H,4-5H2,1-3H3/t7-,10-/m0/s1 |
| InChIKey | POOJVLWLQZQJLV-XVKPBYJWSA-N |
| XLogP | 0.00 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |