C21H33N3O8 — CID 11328536
2-O-ethyl 1-O,3-O-dimethyl 2-cyano-1,3-bis(2,2-dimethylpropanoylamino)propane-1,2,3-tricarboxylate (PubChem CID 11328536) has the molecular formula C21H33N3O8 and a molecular weight of 455.51 g/mol. Its IUPAC name is 2-O-ethyl 1-O,3-O-dimethyl 2-cyano-1,3-bis(2,2-dimethylpropanoylamino)propane-1,2,3-tricarboxylate.
| Compound Name | 2-O-ethyl 1-O,3-O-dimethyl 2-cyano-1,3-bis(2,2-dimethylpropanoylamino)propane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 11328536 |
| Molecular Formula | C21H33N3O8 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 2-O-ethyl 1-O,3-O-dimethyl 2-cyano-1,3-bis(2,2-dimethylpropanoylamino)propane-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)C(C#N)(C(NC(=O)C(C)(C)C)C(=O)OC)C(NC(=O)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C21H33N3O8/c1-10-32-18(29)21(11-22,12(14(25)30-8)23-16(27)19(2,3)4)13(15(26)31-9)24-17(28)20(5,6)7/h12-13H,10H2,1-9H3,(H,23,27)(H,24,28) |
| InChIKey | OEBFSBADJGNBSF-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 160.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|