C11H16O2 — CID 101049557
3-methyl-2-[(E,2R)-pent-3-en-2-yl]oxycyclopent-2-en-1-one (PubChem CID 101049557) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-methyl-2-[(E,2R)-pent-3-en-2-yl]oxycyclopent-2-en-1-one.
| Compound Name | 3-methyl-2-[(E,2R)-pent-3-en-2-yl]oxycyclopent-2-en-1-one |
|---|---|
| PubChem CID | 101049557 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 3-methyl-2-[(E,2R)-pent-3-en-2-yl]oxycyclopent-2-en-1-one |
| SMILES | C/C=C/[C@@H](C)OC1=C(C)CCC1=O |
| InChI | InChI=1S/C11H16O2/c1-4-5-9(3)13-11-8(2)6-7-10(11)12/h4-5,9H,6-7H2,1-3H3/b5-4+/t9-/m1/s1 |
| InChIKey | HPBSSJKXMHNSOF-XNPJLODASA-N |
| XLogP | 2.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|