C25H38F2S — CID 101049674
[(1S,2R)-1,2-difluoro-2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]sulfanylbenzene (PubChem CID 101049674) has the molecular formula C25H38F2S and a molecular weight of 408.64 g/mol. Its IUPAC name is [(1S,2R)-1,2-difluoro-2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]sulfanylbenzene.
| Compound Name | [(1S,2R)-1,2-difluoro-2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]sulfanylbenzene |
|---|---|
| PubChem CID | 101049674 |
| Molecular Formula | C25H38F2S |
| Molecular Weight | 408.64 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | [(1S,2R)-1,2-difluoro-2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]sulfanylbenzene |
| SMILES | CCCCCC1CCC(C2CCC([C@@H](F)[C@@H](F)Sc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C25H38F2S/c1-2-3-5-8-19-11-13-20(14-12-19)21-15-17-22(18-16-21)24(26)25(27)28-23-9-6-4-7-10-23/h4,6-7,9-10,19-22,24-25H,2-3,5,8,11-18H2,1H3/t19?,20?,21?,22?,24-,25+/m1/s1 |
| InChIKey | KQGABPHPZZDPCA-WDSKVTLASA-N |
| XLogP | 8.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.64 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|