C18H28OS — CID 19993165
(4-pentylcyclohexyl)methoxysulfanylbenzene (PubChem CID 19993165) has the molecular formula C18H28OS and a molecular weight of 292.49 g/mol. Its IUPAC name is (4-pentylcyclohexyl)methoxysulfanylbenzene.
| Compound Name | (4-pentylcyclohexyl)methoxysulfanylbenzene |
|---|---|
| PubChem CID | 19993165 |
| Molecular Formula | C18H28OS |
| Molecular Weight | 292.49 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (4-pentylcyclohexyl)methoxysulfanylbenzene |
| SMILES | CCCCCC1CCC(COSc2ccccc2)CC1 |
| InChI | InChI=1S/C18H28OS/c1-2-3-5-8-16-11-13-17(14-12-16)15-19-20-18-9-6-4-7-10-18/h4,6-7,9-10,16-17H,2-3,5,8,11-15H2,1H3 |
| InChIKey | SFABULUNODNBAY-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.49 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|