About 2-(4-heptylcyclohexyl)ethynylsulfanylbenzene;pentahydrofluoride
2-(4-heptylcyclohexyl)ethynylsulfanylbenzene;pentahydrofluoride (PubChem CID 67939357) has the molecular formula C21H35F5S
and a molecular weight of 414.57 g/mol. Its IUPAC name is 2-(4-heptylcyclohexyl)ethynylsulfanylbenzene;pentahydrofluoride.
Molecular Properties
| Compound Name | 2-(4-heptylcyclohexyl)ethynylsulfanylbenzene;pentahydrofluoride |
| PubChem CID | 67939357 |
| Molecular Formula | C21H35F5S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 2-(4-heptylcyclohexyl)ethynylsulfanylbenzene;pentahydrofluoride |
| SMILES | CCCCCCCC1CCC(C#CSc2ccccc2)CC1.F.F.F.F.F |
| InChI | InChI=1S/C21H30S.5FH/c1-2-3-4-5-7-10-19-13-15-20(16-14-19)17-18-22-21-11-8-6-9-12-21;;;;;/h6,8-9,11-12,19-20H,2-5,7,10,13-16H2,1H3;5*1H |
| InChIKey | QFWGEJGLNQBLGO-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-heptylcyclohexyl)ethynylsulfanylbenzene;pentahydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-heptylcyclohexyl)ethynylsulfanylbenzene;pentahydrofluoride?
The IUPAC name of 2-(4-heptylcyclohexyl)ethynylsulfanylbenzene;pentahydrofluoride (CID 67939357) is 2-(4-heptylcyclohexyl)ethynylsulfanylbenzene;pentahydrofluoride.
What is the SMILES notation for 2-(4-heptylcyclohexyl)ethynylsulfanylbenzene;pentahydrofluoride?
The canonical SMILES for 2-(4-heptylcyclohexyl)ethynylsulfanylbenzene;pentahydrofluoride is CCCCCCCC1CCC(C#CSc2ccccc2)CC1.F.F.F.F.F.
What is the InChIKey of 2-(4-heptylcyclohexyl)ethynylsulfanylbenzene;pentahydrofluoride?
The InChIKey is QFWGEJGLNQBLGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30S.5FH/c1-2-3-4-5-7-10-19-13-15-20(16-14-19)17-18-22-21-11-8-6-9-12-21;;;;;/h6,8-9,11-12,19-20H,2-5,7,10,13-16H2,1H3;5*1H.
What are the key properties of 2-(4-heptylcyclohexyl)ethynylsulfanylbenzene;pentahydrofluoride?
2-(4-heptylcyclohexyl)ethynylsulfanylbenzene;pentahydrofluoride has a molecular weight of 414.57 g/mol, XLogP of 7.67, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-heptylcyclohexyl)ethynylsulfanylbenzene;pentahydrofluoride is sourced from PubChem (CID 67939357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).