C11H13ClN2O — CID 10105065
2,4,7-trimethylpyrido[1,2-a]pyrimidin-5-ium-9-ol chloride (PubChem CID 10105065) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is 2,4,7-trimethylpyrido[1,2-a]pyrimidin-5-ium-9-ol chloride.
| Compound Name | 2,4,7-trimethylpyrido[1,2-a]pyrimidin-5-ium-9-ol chloride |
|---|---|
| PubChem CID | 10105065 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2,4,7-trimethylpyrido[1,2-a]pyrimidin-5-ium-9-ol chloride |
| SMILES | Cc1cc(O)c2nc(C)cc(C)[n+]2c1.[Cl-] |
| InChI | InChI=1S/C11H12N2O.ClH/c1-7-4-10(14)11-12-8(2)5-9(3)13(11)6-7;/h4-6H,1-3H3;1H |
| InChIKey | WUOUGALNMCJZDY-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 37.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|