C28H24O5 — CID 101050879
2,15-dioxapentacyclo[22.3.1.13,7.110,14.016,21]triaconta-1(27),3(30),4,6,10(29),11,13,16(21),17,19,24(28),25-dodecaene-4,5,17-triol (PubChem CID 101050879) has the molecular formula C28H24O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is 2,15-dioxapentacyclo[22.3.1.13,7.110,14.016,21]triaconta-1(27),3(30),4,6,10(29),11,13,16(21),17,19,24(28),25-dodecaene-4,5,17-triol.
| Compound Name | 2,15-dioxapentacyclo[22.3.1.13,7.110,14.016,21]triaconta-1(27),3(30),4,6,10(29),11,13,16(21),17,19,24(28),25-dodecaene-4,5,17-triol |
|---|---|
| PubChem CID | 101050879 |
| Molecular Formula | C28H24O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2,15-dioxapentacyclo[22.3.1.13,7.110,14.016,21]triaconta-1(27),3(30),4,6,10(29),11,13,16(21),17,19,24(28),25-dodecaene-4,5,17-triol |
| SMILES | Oc1cc2cc(c1O)Oc1cccc(c1)CCc1cccc(O)c1Oc1cccc(c1)CC2 |
| InChI | InChI=1S/C28H24O5/c29-24-9-3-6-21-13-12-19-5-1-7-22(14-19)32-26-17-20(16-25(30)27(26)31)11-10-18-4-2-8-23(15-18)33-28(21)24/h1-9,14-17,29-31H,10-13H2 |
| InChIKey | BVDHCTQWTJNYDG-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|