C11H17NO2 — CID 101051128
(1S,8Z,10aS)-1-ethyl-1,5,6,7,10,10a-hexahydro-[1,3]oxazolo[3,4-a]azocin-3-one (PubChem CID 101051128) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (1S,8Z,10aS)-1-ethyl-1,5,6,7,10,10a-hexahydro-[1,3]oxazolo[3,4-a]azocin-3-one.
| Compound Name | (1S,8Z,10aS)-1-ethyl-1,5,6,7,10,10a-hexahydro-[1,3]oxazolo[3,4-a]azocin-3-one |
|---|---|
| PubChem CID | 101051128 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (1S,8Z,10aS)-1-ethyl-1,5,6,7,10,10a-hexahydro-[1,3]oxazolo[3,4-a]azocin-3-one |
| SMILES | CC[C@@H]1OC(=O)N2CCC/C=C\C[C@@H]12 |
| InChI | InChI=1S/C11H17NO2/c1-2-10-9-7-5-3-4-6-8-12(9)11(13)14-10/h3,5,9-10H,2,4,6-8H2,1H3/b5-3-/t9-,10-/m0/s1 |
| InChIKey | BUROAJTXKRZBMC-XMWDXMLXSA-N |
| XLogP | 2.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|