C9H11F2NO2 — CID 11367689
(7Z,10aR)-10,10-difluoro-5,6,9,10a-tetrahydro-1H-[1,3]oxazolo[3,4-a]azocin-3-one (PubChem CID 11367689) has the molecular formula C9H11F2NO2 and a molecular weight of 203.19 g/mol. Its IUPAC name is (7Z,10aR)-10,10-difluoro-5,6,9,10a-tetrahydro-1H-[1,3]oxazolo[3,4-a]azocin-3-one.
| Compound Name | (7Z,10aR)-10,10-difluoro-5,6,9,10a-tetrahydro-1H-[1,3]oxazolo[3,4-a]azocin-3-one |
|---|---|
| PubChem CID | 11367689 |
| Molecular Formula | C9H11F2NO2 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | (7Z,10aR)-10,10-difluoro-5,6,9,10a-tetrahydro-1H-[1,3]oxazolo[3,4-a]azocin-3-one |
| SMILES | O=C1OC[C@H]2N1CC/C=C\CC2(F)F |
| InChI | InChI=1S/C9H11F2NO2/c10-9(11)4-2-1-3-5-12-7(9)6-14-8(12)13/h1-2,7H,3-6H2/b2-1-/t7-/m1/s1 |
| InChIKey | KQIPOWIGCGRUAA-TWJVDONLSA-N |
| XLogP | 1.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|