C13H10N4 — CID 101051404
2-amino-1-benzylpyrrole-3,4-di(15N)carbonitrile (PubChem CID 101051404) has the molecular formula C13H10N4 and a molecular weight of 223.24 g/mol. Its IUPAC name is 2-amino-1-benzylpyrrole-3,4-di(15N)carbonitrile.
| Compound Name | 2-amino-1-benzylpyrrole-3,4-di(15N)carbonitrile |
|---|---|
| PubChem CID | 101051404 |
| Molecular Formula | C13H10N4 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 2-amino-1-benzylpyrrole-3,4-di(15N)carbonitrile |
| SMILES | N#Cc1c(C#[15N])cn(Cc2ccccc2)c1N |
| InChI | InChI=1S/C13H10N4/c14-6-11-9-17(13(16)12(11)7-15)8-10-4-2-1-3-5-10/h1-5,9H,8,16H2/i14+1 |
| InChIKey | AROOOZGGMAVJHK-UJKGMGNHSA-N |
| XLogP | 1.86 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |