C15H27NO8S2 — CID 101051872
methyl 3-[(2R,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-sulfanyloxan-2-yl]sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 101051872) has the molecular formula C15H27NO8S2 and a molecular weight of 413.51 g/mol. Its IUPAC name is methyl 3-[(2R,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-sulfanyloxan-2-yl]sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl 3-[(2R,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-sulfanyloxan-2-yl]sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 101051872 |
| Molecular Formula | C15H27NO8S2 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | methyl 3-[(2R,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-sulfanyloxan-2-yl]sulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)C(CS[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1S)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27NO8S2/c1-15(2,3)24-14(21)16-7(12(20)22-4)6-26-13-11(25)10(19)9(18)8(5-17)23-13/h7-11,13,17-19,25H,5-6H2,1-4H3,(H,16,21)/t7?,8-,9-,10+,11+,13-/m1/s1 |
| InChIKey | FSLAIYMWVPRSHH-DMNFSCBUSA-N |
| XLogP | -0.48 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|