C18H13FN2O6 — CID 101052026
methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(4-fluoro-3-nitrophenyl)propanoate (PubChem CID 101052026) has the molecular formula C18H13FN2O6 and a molecular weight of 372.31 g/mol. Its IUPAC name is methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(4-fluoro-3-nitrophenyl)propanoate.
| Compound Name | methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(4-fluoro-3-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 101052026 |
| Molecular Formula | C18H13FN2O6 |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-(4-fluoro-3-nitrophenyl)propanoate |
| SMILES | COC(=O)C(Cc1ccc(F)c([N+](=O)[O-])c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H13FN2O6/c1-27-18(24)15(9-10-6-7-13(19)14(8-10)21(25)26)20-16(22)11-4-2-3-5-12(11)17(20)23/h2-8,15H,9H2,1H3 |
| InChIKey | AMTZHDGYLWPZAO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|