3-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoic acid

C17H12N2O6 — CID 2865084

IUPAC3-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoic acid
SMILESO=C(O)CC(c1ccccc1)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O
InChIInChI=1S/C17H12N2O6/c20-14(21)9-13(10-5-2-1-3-6-10)18-16(22)11-7-4-8-12(19(24)25)15(11)17(18)23/h1-8,13H,9H2,(H,20,21)
InChIKeyWNXPSCOODSMEKU-UHFFFAOYSA-N
MW340.29 g/mol
LogP2.41
Rot. Bonds5

About 3-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoic acid

3-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoic acid (PubChem CID 2865084) has the molecular formula C17H12N2O6 and a molecular weight of 340.29 g/mol. Its IUPAC name is 3-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoic acid.

Molecular Properties

Compound Name3-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoic acid
PubChem CID2865084
Molecular FormulaC17H12N2O6
Molecular Weight340.29 g/mol
Exact Mass340.07
IUPAC Name3-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoic acid
SMILESO=C(O)CC(c1ccccc1)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O
InChIInChI=1S/C17H12N2O6/c20-14(21)9-13(10-5-2-1-3-6-10)18-16(22)11-7-4-8-12(19(24)25)15(11)17(18)23/h1-8,13H,9H2,(H,20,21)
InChIKeyWNXPSCOODSMEKU-UHFFFAOYSA-N
XLogP2.41
TPSA117.82 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500340.29
LogP ≤ 52.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 3-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoic acid?
The IUPAC name of 3-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoic acid (CID 2865084) is 3-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoic acid.
What is the SMILES notation for 3-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoic acid?
The canonical SMILES for 3-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoic acid is O=C(O)CC(c1ccccc1)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O.
What is the InChIKey of 3-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoic acid?
The InChIKey is WNXPSCOODSMEKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O6/c20-14(21)9-13(10-5-2-1-3-6-10)18-16(22)11-7-4-8-12(19(24)25)15(11)17(18)23/h1-8,13H,9H2,(H,20,21).
What are the key properties of 3-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoic acid?
3-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoic acid has a molecular weight of 340.29 g/mol, XLogP of 2.41, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-nitro-1,3-dioxoisoindol-2-yl)-3-phenylpropanoic acid is sourced from PubChem (CID 2865084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).