C25H44O5 — CID 101054889
propan-2-yl (2E,12E,16E)-7,9,15-trihydroxy-2,6,8,14-tetramethyloctadeca-2,12,16-trienoate (PubChem CID 101054889) has the molecular formula C25H44O5 and a molecular weight of 424.62 g/mol. Its IUPAC name is propan-2-yl (2E,12E,16E)-7,9,15-trihydroxy-2,6,8,14-tetramethyloctadeca-2,12,16-trienoate.
| Compound Name | propan-2-yl (2E,12E,16E)-7,9,15-trihydroxy-2,6,8,14-tetramethyloctadeca-2,12,16-trienoate |
|---|---|
| PubChem CID | 101054889 |
| Molecular Formula | C25H44O5 |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | propan-2-yl (2E,12E,16E)-7,9,15-trihydroxy-2,6,8,14-tetramethyloctadeca-2,12,16-trienoate |
| SMILES | C/C=C/C(O)C(C)/C=C/CCC(O)C(C)C(O)C(C)CC/C=C(\C)C(=O)OC(C)C |
| InChI | InChI=1S/C25H44O5/c1-8-12-22(26)18(4)13-9-10-16-23(27)21(7)24(28)19(5)14-11-15-20(6)25(29)30-17(2)3/h8-9,12-13,15,17-19,21-24,26-28H,10-11,14,16H2,1-7H3/b12-8+,13-9+,20-15+ |
| InChIKey | ZKUDFEOEUFLFTI-IYMUNYIMSA-N |
| XLogP | 4.57 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|